C26H38 — CID 23336050
4-[1-(3,4-dimethylphenyl)decyl]-1,2-dimethylbenzene (PubChem CID 23336050) has the molecular formula C26H38 and a molecular weight of 350.59 g/mol. Its IUPAC name is 4-[1-(3,4-dimethylphenyl)decyl]-1,2-dimethylbenzene.
| Compound Name | 4-[1-(3,4-dimethylphenyl)decyl]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 23336050 |
| Molecular Formula | C26H38 |
| Molecular Weight | 350.59 g/mol |
| Exact Mass | 350.30 |
| IUPAC Name | 4-[1-(3,4-dimethylphenyl)decyl]-1,2-dimethylbenzene |
| SMILES | CCCCCCCCCC(c1ccc(C)c(C)c1)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C26H38/c1-6-7-8-9-10-11-12-13-26(24-16-14-20(2)22(4)18-24)25-17-15-21(3)23(5)19-25/h14-19,26H,6-13H2,1-5H3 |
| InChIKey | QFFJDWRBLFZCJD-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.59 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|