C14H24ClN — CID 171200481
(1R)-1-(3,4-dimethylphenyl)hexan-1-amine;hydrochloride (PubChem CID 171200481) has the molecular formula C14H24ClN and a molecular weight of 241.81 g/mol. Its IUPAC name is (1R)-1-(3,4-dimethylphenyl)hexan-1-amine;hydrochloride.
| Compound Name | (1R)-1-(3,4-dimethylphenyl)hexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171200481 |
| Molecular Formula | C14H24ClN |
| Molecular Weight | 241.81 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | (1R)-1-(3,4-dimethylphenyl)hexan-1-amine;hydrochloride |
| SMILES | CCCCC[C@@H](N)c1ccc(C)c(C)c1.Cl |
| InChI | InChI=1S/C14H23N.ClH/c1-4-5-6-7-14(15)13-9-8-11(2)12(3)10-13;/h8-10,14H,4-7,15H2,1-3H3;1H/t14-;/m1./s1 |
| InChIKey | FMFJZBWUDMJCON-PFEQFJNWSA-N |
| XLogP | 4.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.81 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|