C26H32FN2O4P — CID 54670382
3-[[6-(3-fluorophenyl)-5-(4-pentoxyphenyl)-2-pyridinyl]methylamino]propylphosphonic acid (PubChem CID 54670382) has the molecular formula C26H32FN2O4P and a molecular weight of 486.52 g/mol. Its IUPAC name is 3-[[6-(3-fluorophenyl)-5-(4-pentoxyphenyl)-2-pyridinyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[6-(3-fluorophenyl)-5-(4-pentoxyphenyl)-2-pyridinyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 54670382 |
| Molecular Formula | C26H32FN2O4P |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 3-[[6-(3-fluorophenyl)-5-(4-pentoxyphenyl)-2-pyridinyl]methylamino]propylphosphonic acid |
| SMILES | CCCCCOc1ccc(-c2ccc(CNCCCP(=O)(O)O)nc2-c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C26H32FN2O4P/c1-2-3-4-16-33-24-12-9-20(10-13-24)25-14-11-23(19-28-15-6-17-34(30,31)32)29-26(25)21-7-5-8-22(27)18-21/h5,7-14,18,28H,2-4,6,15-17,19H2,1H3,(H2,30,31,32) |
| InChIKey | PNXFLXMYIYXFGH-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|