C25H30NO3P — CID 58104125
6-[5-(4-ethylphenyl)-6-phenyl-2-pyridinyl]hexylphosphonic acid (PubChem CID 58104125) has the molecular formula C25H30NO3P and a molecular weight of 423.49 g/mol. Its IUPAC name is 6-[5-(4-ethylphenyl)-6-phenyl-2-pyridinyl]hexylphosphonic acid.
| Compound Name | 6-[5-(4-ethylphenyl)-6-phenyl-2-pyridinyl]hexylphosphonic acid |
|---|---|
| PubChem CID | 58104125 |
| Molecular Formula | C25H30NO3P |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 6-[5-(4-ethylphenyl)-6-phenyl-2-pyridinyl]hexylphosphonic acid |
| SMILES | CCc1ccc(-c2ccc(CCCCCCP(=O)(O)O)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H30NO3P/c1-2-20-13-15-21(16-14-20)24-18-17-23(12-8-3-4-9-19-30(27,28)29)26-25(24)22-10-6-5-7-11-22/h5-7,10-11,13-18H,2-4,8-9,12,19H2,1H3,(H2,27,28,29) |
| InChIKey | JVEFCFWSDMEHDM-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|