C25H32NO4PS — CID 147794757
5-[5-(5-phenylpentoxy)-6-thiophen-2-yl-2-pyridinyl]pentylphosphonic acid (PubChem CID 147794757) has the molecular formula C25H32NO4PS and a molecular weight of 473.58 g/mol. Its IUPAC name is 5-[5-(5-phenylpentoxy)-6-thiophen-2-yl-2-pyridinyl]pentylphosphonic acid.
| Compound Name | 5-[5-(5-phenylpentoxy)-6-thiophen-2-yl-2-pyridinyl]pentylphosphonic acid |
|---|---|
| PubChem CID | 147794757 |
| Molecular Formula | C25H32NO4PS |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 5-[5-(5-phenylpentoxy)-6-thiophen-2-yl-2-pyridinyl]pentylphosphonic acid |
| SMILES | O=P(O)(O)CCCCCc1ccc(OCCCCCc2ccccc2)c(-c2cccs2)n1 |
| InChI | InChI=1S/C25H32NO4PS/c27-31(28,29)19-9-3-7-14-22-16-17-23(25(26-22)24-15-10-20-32-24)30-18-8-2-6-13-21-11-4-1-5-12-21/h1,4-5,10-12,15-17,20H,2-3,6-9,13-14,18-19H2,(H2,27,28,29) |
| InChIKey | HKILFNITOQTFEI-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|