C25H30F3N2O5PS — CID 59384370
[(2S)-2-amino-2-[5-[4-(6-phenylhexoxy)-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propyl] dihydrogen phosphate (PubChem CID 59384370) has the molecular formula C25H30F3N2O5PS and a molecular weight of 558.56 g/mol. Its IUPAC name is [(2S)-2-amino-2-[5-[4-(6-phenylhexoxy)-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propyl] dihydrogen phosphate.
| Compound Name | [(2S)-2-amino-2-[5-[4-(6-phenylhexoxy)-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 59384370 |
| Molecular Formula | C25H30F3N2O5PS |
| Molecular Weight | 558.56 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | [(2S)-2-amino-2-[5-[4-(6-phenylhexoxy)-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propyl] dihydrogen phosphate |
| SMILES | C[C@](N)(COP(=O)(O)O)c1ncc(-c2ccc(OCCCCCCc3ccccc3)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C25H30F3N2O5PS/c1-24(29,17-35-36(31,32)33)23-30-16-22(37-23)19-12-13-21(20(15-19)25(26,27)28)34-14-8-3-2-5-9-18-10-6-4-7-11-18/h4,6-7,10-13,15-16H,2-3,5,8-9,14,17,29H2,1H3,(H2,31,32,33)/t24-/m0/s1 |
| InChIKey | ABAYVJMAHRALHQ-DEOSSOPVSA-N |
| XLogP | 6.29 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.56 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|