C21H30F3N2O6PS — CID 59384431
[2-amino-3-hydroxy-2-[5-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propyl] dihydrogen phosphate (PubChem CID 59384431) has the molecular formula C21H30F3N2O6PS and a molecular weight of 526.51 g/mol. Its IUPAC name is [2-amino-3-hydroxy-2-[5-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propyl] dihydrogen phosphate.
| Compound Name | [2-amino-3-hydroxy-2-[5-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 59384431 |
| Molecular Formula | C21H30F3N2O6PS |
| Molecular Weight | 526.51 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | [2-amino-3-hydroxy-2-[5-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propyl] dihydrogen phosphate |
| SMILES | CCCCCCCCOc1ccc(-c2cnc(C(N)(CO)COP(=O)(O)O)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H30F3N2O6PS/c1-2-3-4-5-6-7-10-31-17-9-8-15(11-16(17)21(22,23)24)18-12-26-19(34-18)20(25,13-27)14-32-33(28,29)30/h8-9,11-12,27H,2-7,10,13-14,25H2,1H3,(H2,28,29,30) |
| InChIKey | CPJSJZRMINWEAK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 135.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|