C20H27F3N2O3S — CID 24861481
(2S)-2-amino-2-[5-[4-(2-pentoxyethoxy)-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propan-1-ol (PubChem CID 24861481) has the molecular formula C20H27F3N2O3S and a molecular weight of 432.51 g/mol. Its IUPAC name is (2S)-2-amino-2-[5-[4-(2-pentoxyethoxy)-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propan-1-ol.
| Compound Name | (2S)-2-amino-2-[5-[4-(2-pentoxyethoxy)-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 24861481 |
| Molecular Formula | C20H27F3N2O3S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | (2S)-2-amino-2-[5-[4-(2-pentoxyethoxy)-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propan-1-ol |
| SMILES | CCCCCOCCOc1ccc(-c2cnc([C@@](C)(N)CO)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H27F3N2O3S/c1-3-4-5-8-27-9-10-28-16-7-6-14(11-15(16)20(21,22)23)17-12-25-18(29-17)19(2,24)13-26/h6-7,11-12,26H,3-5,8-10,13,24H2,1-2H3/t19-/m0/s1 |
| InChIKey | KNPGPESZXXGFOH-IBGZPJMESA-N |
| XLogP | 4.58 |
| TPSA | 77.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|