C23H25F3N2O3S — CID 24860616
(2S)-2-amino-2-[5-[4-(4-phenoxybutoxy)-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propan-1-ol (PubChem CID 24860616) has the molecular formula C23H25F3N2O3S and a molecular weight of 466.53 g/mol. Its IUPAC name is (2S)-2-amino-2-[5-[4-(4-phenoxybutoxy)-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propan-1-ol.
| Compound Name | (2S)-2-amino-2-[5-[4-(4-phenoxybutoxy)-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 24860616 |
| Molecular Formula | C23H25F3N2O3S |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | (2S)-2-amino-2-[5-[4-(4-phenoxybutoxy)-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propan-1-ol |
| SMILES | C[C@](N)(CO)c1ncc(-c2ccc(OCCCCOc3ccccc3)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C23H25F3N2O3S/c1-22(27,15-29)21-28-14-20(32-21)16-9-10-19(18(13-16)23(24,25)26)31-12-6-5-11-30-17-7-3-2-4-8-17/h2-4,7-10,13-14,29H,5-6,11-12,15,27H2,1H3/t22-/m0/s1 |
| InChIKey | LPKOOWIYCGYSPY-QFIPXVFZSA-N |
| XLogP | 5.23 |
| TPSA | 77.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|