C22H25F3N3O6PS — CID 24860921
[(2S)-2-amino-2-[5-[4-(4-phenoxybutoxy)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propyl] dihydrogen phosphate (PubChem CID 24860921) has the molecular formula C22H25F3N3O6PS and a molecular weight of 547.49 g/mol. Its IUPAC name is [(2S)-2-amino-2-[5-[4-(4-phenoxybutoxy)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propyl] dihydrogen phosphate.
| Compound Name | [(2S)-2-amino-2-[5-[4-(4-phenoxybutoxy)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 24860921 |
| Molecular Formula | C22H25F3N3O6PS |
| Molecular Weight | 547.49 g/mol |
| Exact Mass | 547.12 |
| IUPAC Name | [(2S)-2-amino-2-[5-[4-(4-phenoxybutoxy)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propyl] dihydrogen phosphate |
| SMILES | C[C@](N)(COP(=O)(O)O)c1nnc(-c2ccc(OCCCCOc3ccccc3)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C22H25F3N3O6PS/c1-21(26,14-34-35(29,30)31)20-28-27-19(36-20)15-9-10-18(17(13-15)22(23,24)25)33-12-6-5-11-32-16-7-3-2-4-8-16/h2-4,7-10,13H,5-6,11-12,14,26H2,1H3,(H2,29,30,31)/t21-/m0/s1 |
| InChIKey | VQXYOHJIUHEOAK-NRFANRHFSA-N |
| XLogP | 4.75 |
| TPSA | 137.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|