C22H24ClF3N3O6PS — CID 59149534
[(2S)-2-amino-2-[5-[4-[4-(3-chlorophenoxy)butoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propyl] dihydrogen phosphate (PubChem CID 59149534) has the molecular formula C22H24ClF3N3O6PS and a molecular weight of 581.94 g/mol. Its IUPAC name is [(2S)-2-amino-2-[5-[4-[4-(3-chlorophenoxy)butoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propyl] dihydrogen phosphate.
| Compound Name | [(2S)-2-amino-2-[5-[4-[4-(3-chlorophenoxy)butoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 59149534 |
| Molecular Formula | C22H24ClF3N3O6PS |
| Molecular Weight | 581.94 g/mol |
| Exact Mass | 581.08 |
| IUPAC Name | [(2S)-2-amino-2-[5-[4-[4-(3-chlorophenoxy)butoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propyl] dihydrogen phosphate |
| SMILES | C[C@](N)(COP(=O)(O)O)c1nnc(-c2ccc(OCCCCOc3cccc(Cl)c3)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C22H24ClF3N3O6PS/c1-21(27,13-35-36(30,31)32)20-29-28-19(37-20)14-7-8-18(17(11-14)22(24,25)26)34-10-3-2-9-33-16-6-4-5-15(23)12-16/h4-8,11-12H,2-3,9-10,13,27H2,1H3,(H2,30,31,32)/t21-/m0/s1 |
| InChIKey | GUSSQDNPNRPIAP-NRFANRHFSA-N |
| XLogP | 5.40 |
| TPSA | 137.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.94 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|