C22H23F5N3O6PS — CID 24861374
[(2S)-2-amino-2-[5-[4-[4-(2,4-difluorophenoxy)butoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propyl] dihydrogen phosphate (PubChem CID 24861374) has the molecular formula C22H23F5N3O6PS and a molecular weight of 583.47 g/mol. Its IUPAC name is [(2S)-2-amino-2-[5-[4-[4-(2,4-difluorophenoxy)butoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propyl] dihydrogen phosphate.
| Compound Name | [(2S)-2-amino-2-[5-[4-[4-(2,4-difluorophenoxy)butoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 24861374 |
| Molecular Formula | C22H23F5N3O6PS |
| Molecular Weight | 583.47 g/mol |
| Exact Mass | 583.10 |
| IUPAC Name | [(2S)-2-amino-2-[5-[4-[4-(2,4-difluorophenoxy)butoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propyl] dihydrogen phosphate |
| SMILES | C[C@](N)(COP(=O)(O)O)c1nnc(-c2ccc(OCCCCOc3ccc(F)cc3F)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C22H23F5N3O6PS/c1-21(28,12-36-37(31,32)33)20-30-29-19(38-20)13-4-6-17(15(10-13)22(25,26)27)34-8-2-3-9-35-18-7-5-14(23)11-16(18)24/h4-7,10-11H,2-3,8-9,12,28H2,1H3,(H2,31,32,33)/t21-/m0/s1 |
| InChIKey | OSBVCKKMWGWFDU-NRFANRHFSA-N |
| XLogP | 5.02 |
| TPSA | 137.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|