C22H23F4N3O3S — CID 24861148
(2S)-2-amino-2-[5-[4-[4-(3-fluorophenoxy)butoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol (PubChem CID 24861148) has the molecular formula C22H23F4N3O3S and a molecular weight of 485.50 g/mol. Its IUPAC name is (2S)-2-amino-2-[5-[4-[4-(3-fluorophenoxy)butoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol.
| Compound Name | (2S)-2-amino-2-[5-[4-[4-(3-fluorophenoxy)butoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 24861148 |
| Molecular Formula | C22H23F4N3O3S |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | (2S)-2-amino-2-[5-[4-[4-(3-fluorophenoxy)butoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol |
| SMILES | C[C@](N)(CO)c1nnc(-c2ccc(OCCCCOc3cccc(F)c3)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C22H23F4N3O3S/c1-21(27,13-30)20-29-28-19(33-20)14-7-8-18(17(11-14)22(24,25)26)32-10-3-2-9-31-16-6-4-5-15(23)12-16/h4-8,11-12,30H,2-3,9-10,13,27H2,1H3/t21-/m0/s1 |
| InChIKey | HNSXFZXYUYGNNH-NRFANRHFSA-N |
| XLogP | 4.77 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|