C19H26F3N3O3S — CID 24860850
(2S)-2-amino-2-[5-[4-(4-propoxybutoxy)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol (PubChem CID 24860850) has the molecular formula C19H26F3N3O3S and a molecular weight of 433.50 g/mol. Its IUPAC name is (2S)-2-amino-2-[5-[4-(4-propoxybutoxy)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol.
| Compound Name | (2S)-2-amino-2-[5-[4-(4-propoxybutoxy)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 24860850 |
| Molecular Formula | C19H26F3N3O3S |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | (2S)-2-amino-2-[5-[4-(4-propoxybutoxy)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol |
| SMILES | CCCOCCCCOc1ccc(-c2nnc([C@@](C)(N)CO)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C19H26F3N3O3S/c1-3-8-27-9-4-5-10-28-15-7-6-13(11-14(15)19(20,21)22)16-24-25-17(29-16)18(2,23)12-26/h6-7,11,26H,3-5,8-10,12,23H2,1-2H3/t18-/m0/s1 |
| InChIKey | DBESFAFZZFODJC-SFHVURJKSA-N |
| XLogP | 3.98 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|