C20H26F3N3O4S — CID 59149536
(3S)-3-amino-3-[5-[4-(3-butoxypropoxy)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]butanoic acid (PubChem CID 59149536) has the molecular formula C20H26F3N3O4S and a molecular weight of 461.51 g/mol. Its IUPAC name is (3S)-3-amino-3-[5-[4-(3-butoxypropoxy)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]butanoic acid.
| Compound Name | (3S)-3-amino-3-[5-[4-(3-butoxypropoxy)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 59149536 |
| Molecular Formula | C20H26F3N3O4S |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | (3S)-3-amino-3-[5-[4-(3-butoxypropoxy)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]butanoic acid |
| SMILES | CCCCOCCCOc1ccc(-c2nnc([C@@](C)(N)CC(=O)O)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H26F3N3O4S/c1-3-4-8-29-9-5-10-30-15-7-6-13(11-14(15)20(21,22)23)17-25-26-18(31-17)19(2,24)12-16(27)28/h6-7,11H,3-5,8-10,12,24H2,1-2H3,(H,27,28)/t19-/m0/s1 |
| InChIKey | SLVVEFXLHMRHTJ-IBGZPJMESA-N |
| XLogP | 4.46 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|