C23H24F3N3O4S — CID 59149517
(3S)-3-amino-3-[5-[4-[2-(2-phenylethoxy)ethoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]butanoic acid (PubChem CID 59149517) has the molecular formula C23H24F3N3O4S and a molecular weight of 495.52 g/mol. Its IUPAC name is (3S)-3-amino-3-[5-[4-[2-(2-phenylethoxy)ethoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]butanoic acid.
| Compound Name | (3S)-3-amino-3-[5-[4-[2-(2-phenylethoxy)ethoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 59149517 |
| Molecular Formula | C23H24F3N3O4S |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | (3S)-3-amino-3-[5-[4-[2-(2-phenylethoxy)ethoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]butanoic acid |
| SMILES | C[C@](N)(CC(=O)O)c1nnc(-c2ccc(OCCOCCc3ccccc3)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C23H24F3N3O4S/c1-22(27,14-19(30)31)21-29-28-20(34-21)16-7-8-18(17(13-16)23(24,25)26)33-12-11-32-10-9-15-5-3-2-4-6-15/h2-8,13H,9-12,14,27H2,1H3,(H,30,31)/t22-/m0/s1 |
| InChIKey | UKYNUGODLNAZID-QFIPXVFZSA-N |
| XLogP | 4.51 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|