C26H32F3N3O2S — CID 143622009
(2S)-3-methyl-2-[5-[4-[2-(2-phenylethoxy)ethoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]hexan-2-amine (PubChem CID 143622009) has the molecular formula C26H32F3N3O2S and a molecular weight of 507.62 g/mol. Its IUPAC name is (2S)-3-methyl-2-[5-[4-[2-(2-phenylethoxy)ethoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]hexan-2-amine.
| Compound Name | (2S)-3-methyl-2-[5-[4-[2-(2-phenylethoxy)ethoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]hexan-2-amine |
|---|---|
| PubChem CID | 143622009 |
| Molecular Formula | C26H32F3N3O2S |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | (2S)-3-methyl-2-[5-[4-[2-(2-phenylethoxy)ethoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]hexan-2-amine |
| SMILES | CCCC(C)[C@](C)(N)c1nnc(-c2ccc(OCCOCCc3ccccc3)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C26H32F3N3O2S/c1-4-8-18(2)25(3,30)24-32-31-23(35-24)20-11-12-22(21(17-20)26(27,28)29)34-16-15-33-14-13-19-9-6-5-7-10-19/h5-7,9-12,17-18H,4,8,13-16,30H2,1-3H3/t18?,25-/m0/s1 |
| InChIKey | GXNHZSCIYPOQSJ-LYIYLXCWSA-N |
| XLogP | 6.47 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|