C22H25F3N3O6PS — CID 143621981
[2-amino-2-[5-[4-[2-[2-(2-methoxyphenyl)ethoxy]ethoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]ethyl] dihydrogen phosphite (PubChem CID 143621981) has the molecular formula C22H25F3N3O6PS and a molecular weight of 547.49 g/mol. Its IUPAC name is [2-amino-2-[5-[4-[2-[2-(2-methoxyphenyl)ethoxy]ethoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]ethyl] dihydrogen phosphite.
| Compound Name | [2-amino-2-[5-[4-[2-[2-(2-methoxyphenyl)ethoxy]ethoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]ethyl] dihydrogen phosphite |
|---|---|
| PubChem CID | 143621981 |
| Molecular Formula | C22H25F3N3O6PS |
| Molecular Weight | 547.49 g/mol |
| Exact Mass | 547.12 |
| IUPAC Name | [2-amino-2-[5-[4-[2-[2-(2-methoxyphenyl)ethoxy]ethoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]ethyl] dihydrogen phosphite |
| SMILES | COc1ccccc1CCOCCOc1ccc(-c2nnc(C(N)COP(O)O)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H25F3N3O6PS/c1-31-18-5-3-2-4-14(18)8-9-32-10-11-33-19-7-6-15(12-16(19)22(23,24)25)20-27-28-21(36-20)17(26)13-34-35(29)30/h2-7,12,17,29-30H,8-11,13,26H2,1H3 |
| InChIKey | FRRGFERKJMDPFW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 129.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|