C23H22F6N2O3S — CID 143621975
2-[5-[3-(trifluoromethyl)-4-[5-[2-(trifluoromethyl)phenoxy]pentoxy]phenyl]-1,3,4-thiadiazol-2-yl]ethanol (PubChem CID 143621975) has the molecular formula C23H22F6N2O3S and a molecular weight of 520.50 g/mol. Its IUPAC name is 2-[5-[3-(trifluoromethyl)-4-[5-[2-(trifluoromethyl)phenoxy]pentoxy]phenyl]-1,3,4-thiadiazol-2-yl]ethanol.
| Compound Name | 2-[5-[3-(trifluoromethyl)-4-[5-[2-(trifluoromethyl)phenoxy]pentoxy]phenyl]-1,3,4-thiadiazol-2-yl]ethanol |
|---|---|
| PubChem CID | 143621975 |
| Molecular Formula | C23H22F6N2O3S |
| Molecular Weight | 520.50 g/mol |
| Exact Mass | 520.13 |
| IUPAC Name | 2-[5-[3-(trifluoromethyl)-4-[5-[2-(trifluoromethyl)phenoxy]pentoxy]phenyl]-1,3,4-thiadiazol-2-yl]ethanol |
| SMILES | OCCc1nnc(-c2ccc(OCCCCCOc3ccccc3C(F)(F)F)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C23H22F6N2O3S/c24-22(25,26)16-6-2-3-7-18(16)33-12-4-1-5-13-34-19-9-8-15(14-17(19)23(27,28)29)21-31-30-20(35-21)10-11-32/h2-3,6-9,14,32H,1,4-5,10-13H2 |
| InChIKey | HRYCHOJSNZZIHT-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.50 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|