C23H23F6N3O2S — CID 59384315
(2S)-2-amino-2-[5-[3-(trifluoromethyl)-4-[5-(2,4,5-trifluorophenyl)pentoxy]phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol (PubChem CID 59384315) has the molecular formula C23H23F6N3O2S and a molecular weight of 519.51 g/mol. Its IUPAC name is (2S)-2-amino-2-[5-[3-(trifluoromethyl)-4-[5-(2,4,5-trifluorophenyl)pentoxy]phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol.
| Compound Name | (2S)-2-amino-2-[5-[3-(trifluoromethyl)-4-[5-(2,4,5-trifluorophenyl)pentoxy]phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 59384315 |
| Molecular Formula | C23H23F6N3O2S |
| Molecular Weight | 519.51 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | (2S)-2-amino-2-[5-[3-(trifluoromethyl)-4-[5-(2,4,5-trifluorophenyl)pentoxy]phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol |
| SMILES | C[C@](N)(CO)c1nnc(-c2ccc(OCCCCCc3cc(F)c(F)cc3F)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C23H23F6N3O2S/c1-22(30,12-33)21-32-31-20(35-21)14-6-7-19(15(9-14)23(27,28)29)34-8-4-2-3-5-13-10-17(25)18(26)11-16(13)24/h6-7,9-11,33H,2-5,8,12,30H2,1H3/t22-/m0/s1 |
| InChIKey | IICCTLIGFXVAPB-QFIPXVFZSA-N |
| XLogP | 5.60 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.51 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|