C22H23F4N3O2S — CID 59384333
(2S)-2-amino-2-[5-[4-[4-(2-fluorophenyl)butoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol (PubChem CID 59384333) has the molecular formula C22H23F4N3O2S and a molecular weight of 469.50 g/mol. Its IUPAC name is (2S)-2-amino-2-[5-[4-[4-(2-fluorophenyl)butoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol.
| Compound Name | (2S)-2-amino-2-[5-[4-[4-(2-fluorophenyl)butoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 59384333 |
| Molecular Formula | C22H23F4N3O2S |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | (2S)-2-amino-2-[5-[4-[4-(2-fluorophenyl)butoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol |
| SMILES | C[C@](N)(CO)c1nnc(-c2ccc(OCCCCc3ccccc3F)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C22H23F4N3O2S/c1-21(27,13-30)20-29-28-19(32-20)15-9-10-18(16(12-15)22(24,25)26)31-11-5-4-7-14-6-2-3-8-17(14)23/h2-3,6,8-10,12,30H,4-5,7,11,13,27H2,1H3/t21-/m0/s1 |
| InChIKey | UQUXBPWIYZDKRO-NRFANRHFSA-N |
| XLogP | 4.93 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|