C25H29F4N3O2 — CID 68708670
(2S)-2-amino-2-[3-[4-[6-(2-fluorophenyl)hexoxy]-3-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]propan-1-ol (PubChem CID 68708670) has the molecular formula C25H29F4N3O2 and a molecular weight of 479.52 g/mol. Its IUPAC name is (2S)-2-amino-2-[3-[4-[6-(2-fluorophenyl)hexoxy]-3-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]propan-1-ol.
| Compound Name | (2S)-2-amino-2-[3-[4-[6-(2-fluorophenyl)hexoxy]-3-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]propan-1-ol |
|---|---|
| PubChem CID | 68708670 |
| Molecular Formula | C25H29F4N3O2 |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | (2S)-2-amino-2-[3-[4-[6-(2-fluorophenyl)hexoxy]-3-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]propan-1-ol |
| SMILES | C[C@@](N)(CO)c1cc(-c2ccc(OCCCCCCc3ccccc3F)c(C(F)(F)F)c2)n[nH]1 |
| InChI | InChI=1S/C25H29F4N3O2/c1-24(30,16-33)23-15-21(31-32-23)18-11-12-22(19(14-18)25(27,28)29)34-13-7-3-2-4-8-17-9-5-6-10-20(17)26/h5-6,9-12,14-15,33H,2-4,7-8,13,16,30H2,1H3,(H,31,32)/t24-/m1/s1 |
| InChIKey | FRKGYMPRBTXJSU-XMMPIXPASA-N |
| XLogP | 5.58 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|