C23H24F5N3O3S — CID 68539714
2-amino-2-[5-[4-[5-(2,6-difluorophenoxy)pentoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol (PubChem CID 68539714) has the molecular formula C23H24F5N3O3S and a molecular weight of 517.52 g/mol. Its IUPAC name is 2-amino-2-[5-[4-[5-(2,6-difluorophenoxy)pentoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol.
| Compound Name | 2-amino-2-[5-[4-[5-(2,6-difluorophenoxy)pentoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 68539714 |
| Molecular Formula | C23H24F5N3O3S |
| Molecular Weight | 517.52 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | 2-amino-2-[5-[4-[5-(2,6-difluorophenoxy)pentoxy]-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol |
| SMILES | CC(N)(CO)c1nnc(-c2ccc(OCCCCCOc3c(F)cccc3F)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C23H24F5N3O3S/c1-22(29,13-32)21-31-30-20(35-21)14-8-9-18(15(12-14)23(26,27)28)33-10-3-2-4-11-34-19-16(24)6-5-7-17(19)25/h5-9,12,32H,2-4,10-11,13,29H2,1H3 |
| InChIKey | UUBGNLXRYNNHQQ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.52 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|