C18H23F3N2O3S — CID 143622051
2-[5-[4-(4-propoxybutoxy)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]ethanol (PubChem CID 143622051) has the molecular formula C18H23F3N2O3S and a molecular weight of 404.45 g/mol. Its IUPAC name is 2-[5-[4-(4-propoxybutoxy)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]ethanol.
| Compound Name | 2-[5-[4-(4-propoxybutoxy)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]ethanol |
|---|---|
| PubChem CID | 143622051 |
| Molecular Formula | C18H23F3N2O3S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 2-[5-[4-(4-propoxybutoxy)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]ethanol |
| SMILES | CCCOCCCCOc1ccc(-c2nnc(CCO)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C18H23F3N2O3S/c1-2-9-25-10-3-4-11-26-15-6-5-13(12-14(15)18(19,20)21)17-23-22-16(27-17)7-8-24/h5-6,12,24H,2-4,7-11H2,1H3 |
| InChIKey | DHMRDJIZBZOJIK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|