C21H28F3NO3S — CID 143622049
2-methyl-2-[5-[4-(2-pentoxyethoxy)-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propan-1-ol (PubChem CID 143622049) has the molecular formula C21H28F3NO3S and a molecular weight of 431.52 g/mol. Its IUPAC name is 2-methyl-2-[5-[4-(2-pentoxyethoxy)-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propan-1-ol.
| Compound Name | 2-methyl-2-[5-[4-(2-pentoxyethoxy)-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 143622049 |
| Molecular Formula | C21H28F3NO3S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 2-methyl-2-[5-[4-(2-pentoxyethoxy)-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propan-1-ol |
| SMILES | CCCCCOCCOc1ccc(-c2cnc(C(C)(C)CO)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H28F3NO3S/c1-4-5-6-9-27-10-11-28-17-8-7-15(12-16(17)21(22,23)24)18-13-25-19(29-18)20(2,3)14-26/h7-8,12-13,26H,4-6,9-11,14H2,1-3H3 |
| InChIKey | VSMNSFJOTIZOIP-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|