C22H21F6N3O2S — CID 143622472
2-amino-2-[5-[3-(trifluoromethyl)-4-[4-[3-(trifluoromethyl)phenyl]butoxy]phenyl]-1,3,4-thiadiazol-2-yl]ethanol (PubChem CID 143622472) has the molecular formula C22H21F6N3O2S and a molecular weight of 505.48 g/mol. Its IUPAC name is 2-amino-2-[5-[3-(trifluoromethyl)-4-[4-[3-(trifluoromethyl)phenyl]butoxy]phenyl]-1,3,4-thiadiazol-2-yl]ethanol.
| Compound Name | 2-amino-2-[5-[3-(trifluoromethyl)-4-[4-[3-(trifluoromethyl)phenyl]butoxy]phenyl]-1,3,4-thiadiazol-2-yl]ethanol |
|---|---|
| PubChem CID | 143622472 |
| Molecular Formula | C22H21F6N3O2S |
| Molecular Weight | 505.48 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | 2-amino-2-[5-[3-(trifluoromethyl)-4-[4-[3-(trifluoromethyl)phenyl]butoxy]phenyl]-1,3,4-thiadiazol-2-yl]ethanol |
| SMILES | NC(CO)c1nnc(-c2ccc(OCCCCc3cccc(C(F)(F)F)c3)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C22H21F6N3O2S/c23-21(24,25)15-6-3-5-13(10-15)4-1-2-9-33-18-8-7-14(11-16(18)22(26,27)28)19-30-31-20(34-19)17(29)12-32/h3,5-8,10-11,17,32H,1-2,4,9,12,29H2 |
| InChIKey | ACSFMHLRLXSILD-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.48 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|