C23H24F6N3O4PS — CID 143622492
[2-amino-2-[5-[3-(trifluoromethyl)-4-[5-[3-(trifluoromethyl)phenyl]pentoxy]phenyl]-1,3,4-thiadiazol-2-yl]ethyl] dihydrogen phosphite (PubChem CID 143622492) has the molecular formula C23H24F6N3O4PS and a molecular weight of 583.49 g/mol. Its IUPAC name is [2-amino-2-[5-[3-(trifluoromethyl)-4-[5-[3-(trifluoromethyl)phenyl]pentoxy]phenyl]-1,3,4-thiadiazol-2-yl]ethyl] dihydrogen phosphite.
| Compound Name | [2-amino-2-[5-[3-(trifluoromethyl)-4-[5-[3-(trifluoromethyl)phenyl]pentoxy]phenyl]-1,3,4-thiadiazol-2-yl]ethyl] dihydrogen phosphite |
|---|---|
| PubChem CID | 143622492 |
| Molecular Formula | C23H24F6N3O4PS |
| Molecular Weight | 583.49 g/mol |
| Exact Mass | 583.11 |
| IUPAC Name | [2-amino-2-[5-[3-(trifluoromethyl)-4-[5-[3-(trifluoromethyl)phenyl]pentoxy]phenyl]-1,3,4-thiadiazol-2-yl]ethyl] dihydrogen phosphite |
| SMILES | NC(COP(O)O)c1nnc(-c2ccc(OCCCCCc3cccc(C(F)(F)F)c3)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C23H24F6N3O4PS/c24-22(25,26)16-7-4-6-14(11-16)5-2-1-3-10-35-19-9-8-15(12-17(19)23(27,28)29)20-31-32-21(38-20)18(30)13-36-37(33)34/h4,6-9,11-12,18,33-34H,1-3,5,10,13,30H2 |
| InChIKey | MHXSZFVQDRLYOL-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.49 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|