C19H18F6O — CID 141200659
1-(trifluoromethyl)-2-[5-[3-(trifluoromethyl)phenyl]pentoxy]benzene (PubChem CID 141200659) has the molecular formula C19H18F6O and a molecular weight of 376.34 g/mol. Its IUPAC name is 1-(trifluoromethyl)-2-[5-[3-(trifluoromethyl)phenyl]pentoxy]benzene.
| Compound Name | 1-(trifluoromethyl)-2-[5-[3-(trifluoromethyl)phenyl]pentoxy]benzene |
|---|---|
| PubChem CID | 141200659 |
| Molecular Formula | C19H18F6O |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 1-(trifluoromethyl)-2-[5-[3-(trifluoromethyl)phenyl]pentoxy]benzene |
| SMILES | FC(F)(F)c1cccc(CCCCCOc2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C19H18F6O/c20-18(21,22)15-9-6-8-14(13-15)7-2-1-5-12-26-17-11-4-3-10-16(17)19(23,24)25/h3-4,6,8-11,13H,1-2,5,7,12H2 |
| InChIKey | ITYLQNPVEGFPSV-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|