C24H27F5N3O5PS — CID 71132068
[(2S)-2-amino-2-[5-[3-(difluoromethyl)-4-[5-[3-(trifluoromethyl)phenyl]pentoxy]phenyl]-1,3,4-thiadiazol-2-yl]propyl] dihydrogen phosphate (PubChem CID 71132068) has the molecular formula C24H27F5N3O5PS and a molecular weight of 595.53 g/mol. Its IUPAC name is [(2S)-2-amino-2-[5-[3-(difluoromethyl)-4-[5-[3-(trifluoromethyl)phenyl]pentoxy]phenyl]-1,3,4-thiadiazol-2-yl]propyl] dihydrogen phosphate.
| Compound Name | [(2S)-2-amino-2-[5-[3-(difluoromethyl)-4-[5-[3-(trifluoromethyl)phenyl]pentoxy]phenyl]-1,3,4-thiadiazol-2-yl]propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 71132068 |
| Molecular Formula | C24H27F5N3O5PS |
| Molecular Weight | 595.53 g/mol |
| Exact Mass | 595.13 |
| IUPAC Name | [(2S)-2-amino-2-[5-[3-(difluoromethyl)-4-[5-[3-(trifluoromethyl)phenyl]pentoxy]phenyl]-1,3,4-thiadiazol-2-yl]propyl] dihydrogen phosphate |
| SMILES | C[C@](N)(COP(=O)(O)O)c1nnc(-c2ccc(OCCCCCc3cccc(C(F)(F)F)c3)c(C(F)F)c2)s1 |
| InChI | InChI=1S/C24H27F5N3O5PS/c1-23(30,14-37-38(33,34)35)22-32-31-21(39-22)16-9-10-19(18(13-16)20(25)26)36-11-4-2-3-6-15-7-5-8-17(12-15)24(27,28)29/h5,7-10,12-13,20H,2-4,6,11,14,30H2,1H3,(H2,33,34,35)/t23-/m0/s1 |
| InChIKey | NGZOFDVRLLONTD-QHCPKHFHSA-N |
| XLogP | 6.24 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.53 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|