C25H30F3N3O2S — CID 71129748
(2S)-2-amino-2-[5-[3-methyl-4-[6-[3-(trifluoromethyl)phenyl]hexoxy]phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol (PubChem CID 71129748) has the molecular formula C25H30F3N3O2S and a molecular weight of 493.60 g/mol. Its IUPAC name is (2S)-2-amino-2-[5-[3-methyl-4-[6-[3-(trifluoromethyl)phenyl]hexoxy]phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol.
| Compound Name | (2S)-2-amino-2-[5-[3-methyl-4-[6-[3-(trifluoromethyl)phenyl]hexoxy]phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 71129748 |
| Molecular Formula | C25H30F3N3O2S |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | (2S)-2-amino-2-[5-[3-methyl-4-[6-[3-(trifluoromethyl)phenyl]hexoxy]phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol |
| SMILES | Cc1cc(-c2nnc([C@@](C)(N)CO)s2)ccc1OCCCCCCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H30F3N3O2S/c1-17-14-19(22-30-31-23(34-22)24(2,29)16-32)11-12-21(17)33-13-6-4-3-5-8-18-9-7-10-20(15-18)25(26,27)28/h7,9-12,14-15,32H,3-6,8,13,16,29H2,1-2H3/t24-/m0/s1 |
| InChIKey | FUEAUNZZPNJFBE-DEOSSOPVSA-N |
| XLogP | 5.88 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|