C28H33NO3S — CID 53238709
3-[1-[4-(5-phenylpentoxy)-3-thiophen-2-ylphenyl]ethylamino]cyclobutane-1-carboxylic acid (PubChem CID 53238709) has the molecular formula C28H33NO3S and a molecular weight of 463.64 g/mol. Its IUPAC name is 3-[1-[4-(5-phenylpentoxy)-3-thiophen-2-ylphenyl]ethylamino]cyclobutane-1-carboxylic acid.
| Compound Name | 3-[1-[4-(5-phenylpentoxy)-3-thiophen-2-ylphenyl]ethylamino]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 53238709 |
| Molecular Formula | C28H33NO3S |
| Molecular Weight | 463.64 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 3-[1-[4-(5-phenylpentoxy)-3-thiophen-2-ylphenyl]ethylamino]cyclobutane-1-carboxylic acid |
| SMILES | CC(NC1CC(C(=O)O)C1)c1ccc(OCCCCCc2ccccc2)c(-c2cccs2)c1 |
| InChI | InChI=1S/C28H33NO3S/c1-20(29-24-17-23(18-24)28(30)31)22-13-14-26(25(19-22)27-12-8-16-33-27)32-15-7-3-6-11-21-9-4-2-5-10-21/h2,4-5,8-10,12-14,16,19-20,23-24,29H,3,6-7,11,15,17-18H2,1H3,(H,30,31) |
| InChIKey | AXYHUUGRYYVIRG-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.64 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|