C26H29NO4 — CID 53237788
1-[[3-(furan-3-yl)-4-(5-phenylpentoxy)phenyl]methyl]azetidine-3-carboxylic acid (PubChem CID 53237788) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is 1-[[3-(furan-3-yl)-4-(5-phenylpentoxy)phenyl]methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[[3-(furan-3-yl)-4-(5-phenylpentoxy)phenyl]methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 53237788 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 1-[[3-(furan-3-yl)-4-(5-phenylpentoxy)phenyl]methyl]azetidine-3-carboxylic acid |
| SMILES | O=C(O)C1CN(Cc2ccc(OCCCCCc3ccccc3)c(-c3ccoc3)c2)C1 |
| InChI | InChI=1S/C26H29NO4/c28-26(29)23-17-27(18-23)16-21-10-11-25(24(15-21)22-12-14-30-19-22)31-13-6-2-5-9-20-7-3-1-4-8-20/h1,3-4,7-8,10-12,14-15,19,23H,2,5-6,9,13,16-18H2,(H,28,29) |
| InChIKey | MCUKDZKTHMVYRP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|