C20H31NO4 — CID 122125528
1-[(4-butoxy-3-ethoxyphenyl)methyl]-5-methylpiperidine-3-carboxylic acid (PubChem CID 122125528) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is 1-[(4-butoxy-3-ethoxyphenyl)methyl]-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[(4-butoxy-3-ethoxyphenyl)methyl]-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122125528 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | 1-[(4-butoxy-3-ethoxyphenyl)methyl]-5-methylpiperidine-3-carboxylic acid |
| SMILES | CCCCOc1ccc(CN2CC(C)CC(C(=O)O)C2)cc1OCC |
| InChI | InChI=1S/C20H31NO4/c1-4-6-9-25-18-8-7-16(11-19(18)24-5-2)13-21-12-15(3)10-17(14-21)20(22)23/h7-8,11,15,17H,4-6,9-10,12-14H2,1-3H3,(H,22,23) |
| InChIKey | KWIKHEZWXNQCCE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|