C26H32ClNO3 — CID 66854292
1-[[1-methyl-6-(4-phenylbutoxy)-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carboxylic acid;hydrochloride (PubChem CID 66854292) has the molecular formula C26H32ClNO3 and a molecular weight of 442.00 g/mol. Its IUPAC name is 1-[[1-methyl-6-(4-phenylbutoxy)-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carboxylic acid;hydrochloride.
| Compound Name | 1-[[1-methyl-6-(4-phenylbutoxy)-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 66854292 |
| Molecular Formula | C26H32ClNO3 |
| Molecular Weight | 442.00 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 1-[[1-methyl-6-(4-phenylbutoxy)-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carboxylic acid;hydrochloride |
| SMILES | CC1=C(CN2CC(C(=O)O)C2)CCc2cc(OCCCCc3ccccc3)ccc21.Cl |
| InChI | InChI=1S/C26H31NO3.ClH/c1-19-22(16-27-17-23(18-27)26(28)29)11-10-21-15-24(12-13-25(19)21)30-14-6-5-9-20-7-3-2-4-8-20;/h2-4,7-8,12-13,15,23H,5-6,9-11,14,16-18H2,1H3,(H,28,29);1H |
| InChIKey | LMLXYIMTFNNCLM-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.00 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|