C27H33NO3 — CID 66852595
1-[[1-methyl-6-(5-phenylpentoxy)-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carboxylic acid (PubChem CID 66852595) has the molecular formula C27H33NO3 and a molecular weight of 419.57 g/mol. Its IUPAC name is 1-[[1-methyl-6-(5-phenylpentoxy)-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[[1-methyl-6-(5-phenylpentoxy)-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 66852595 |
| Molecular Formula | C27H33NO3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | 1-[[1-methyl-6-(5-phenylpentoxy)-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carboxylic acid |
| SMILES | CC1=C(CN2CC(C(=O)O)C2)CCc2cc(OCCCCCc3ccccc3)ccc21 |
| InChI | InChI=1S/C27H33NO3/c1-20-23(17-28-18-24(19-28)27(29)30)12-11-22-16-25(13-14-26(20)22)31-15-7-3-6-10-21-8-4-2-5-9-21/h2,4-5,8-9,13-14,16,24H,3,6-7,10-12,15,17-19H2,1H3,(H,29,30) |
| InChIKey | YQSYHFZEMDWCQJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|