C25H26ClF2NO3 — CID 23121409
1-[[6-[3-(2-chloro-3,6-difluorophenyl)propoxy]-1-methyl-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carboxylic acid (PubChem CID 23121409) has the molecular formula C25H26ClF2NO3 and a molecular weight of 461.94 g/mol. Its IUPAC name is 1-[[6-[3-(2-chloro-3,6-difluorophenyl)propoxy]-1-methyl-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[[6-[3-(2-chloro-3,6-difluorophenyl)propoxy]-1-methyl-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 23121409 |
| Molecular Formula | C25H26ClF2NO3 |
| Molecular Weight | 461.94 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 1-[[6-[3-(2-chloro-3,6-difluorophenyl)propoxy]-1-methyl-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carboxylic acid |
| SMILES | CC1=C(CN2CC(C(=O)O)C2)CCc2cc(OCCCc3c(F)ccc(F)c3Cl)ccc21 |
| InChI | InChI=1S/C25H26ClF2NO3/c1-15-17(12-29-13-18(14-29)25(30)31)5-4-16-11-19(6-7-20(15)16)32-10-2-3-21-22(27)8-9-23(28)24(21)26/h6-9,11,18H,2-5,10,12-14H2,1H3,(H,30,31) |
| InChIKey | BIJOIXJZOIACKE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.94 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|