C25H29N3O3 — CID 53238476
1-[[4-(5-phenylpentoxy)-3-(1H-pyrazol-4-yl)phenyl]methyl]azetidine-3-carboxylic acid (PubChem CID 53238476) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 1-[[4-(5-phenylpentoxy)-3-(1H-pyrazol-4-yl)phenyl]methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[[4-(5-phenylpentoxy)-3-(1H-pyrazol-4-yl)phenyl]methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 53238476 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 1-[[4-(5-phenylpentoxy)-3-(1H-pyrazol-4-yl)phenyl]methyl]azetidine-3-carboxylic acid |
| SMILES | O=C(O)C1CN(Cc2ccc(OCCCCCc3ccccc3)c(-c3cn[nH]c3)c2)C1 |
| InChI | InChI=1S/C25H29N3O3/c29-25(30)22-17-28(18-22)16-20-10-11-24(23(13-20)21-14-26-27-15-21)31-12-6-2-5-9-19-7-3-1-4-8-19/h1,3-4,7-8,10-11,13-15,22H,2,5-6,9,12,16-18H2,(H,26,27)(H,29,30) |
| InChIKey | NKKWNGNPXONYIQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|