C26H35NO5 — CID 10297096
methyl (3S,4S)-3-[(1S)-1-hydroxyethyl]-4-[4-methoxy-3-(4-phenylbutoxy)phenyl]-3-methylpyrrolidine-1-carboxylate (PubChem CID 10297096) has the molecular formula C26H35NO5 and a molecular weight of 441.57 g/mol. Its IUPAC name is methyl (3S,4S)-3-[(1S)-1-hydroxyethyl]-4-[4-methoxy-3-(4-phenylbutoxy)phenyl]-3-methylpyrrolidine-1-carboxylate.
| Compound Name | methyl (3S,4S)-3-[(1S)-1-hydroxyethyl]-4-[4-methoxy-3-(4-phenylbutoxy)phenyl]-3-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10297096 |
| Molecular Formula | C26H35NO5 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | methyl (3S,4S)-3-[(1S)-1-hydroxyethyl]-4-[4-methoxy-3-(4-phenylbutoxy)phenyl]-3-methylpyrrolidine-1-carboxylate |
| SMILES | COC(=O)N1C[C@@H](c2ccc(OC)c(OCCCCc3ccccc3)c2)[C@](C)([C@H](C)O)C1 |
| InChI | InChI=1S/C26H35NO5/c1-19(28)26(2)18-27(25(29)31-4)17-22(26)21-13-14-23(30-3)24(16-21)32-15-9-8-12-20-10-6-5-7-11-20/h5-7,10-11,13-14,16,19,22,28H,8-9,12,15,17-18H2,1-4H3/t19-,22-,26-/m0/s1 |
| InChIKey | GYRMQJKAPKDMOF-NHZRIVAWSA-N |
| XLogP | 4.65 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|