C23H37NO5 — CID 118927990
tert-butyl (3S,4S)-4-(3-butoxy-4-methoxyphenyl)-3-[(1R)-1-hydroxyethyl]-3-methylpyrrolidine-1-carboxylate (PubChem CID 118927990) has the molecular formula C23H37NO5 and a molecular weight of 407.55 g/mol. Its IUPAC name is tert-butyl (3S,4S)-4-(3-butoxy-4-methoxyphenyl)-3-[(1R)-1-hydroxyethyl]-3-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-4-(3-butoxy-4-methoxyphenyl)-3-[(1R)-1-hydroxyethyl]-3-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118927990 |
| Molecular Formula | C23H37NO5 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | tert-butyl (3S,4S)-4-(3-butoxy-4-methoxyphenyl)-3-[(1R)-1-hydroxyethyl]-3-methylpyrrolidine-1-carboxylate |
| SMILES | CCCCOc1cc([C@@H]2CN(C(=O)OC(C)(C)C)C[C@@]2(C)[C@@H](C)O)ccc1OC |
| InChI | InChI=1S/C23H37NO5/c1-8-9-12-28-20-13-17(10-11-19(20)27-7)18-14-24(15-23(18,6)16(2)25)21(26)29-22(3,4)5/h10-11,13,16,18,25H,8-9,12,14-15H2,1-7H3/t16-,18+,23+/m1/s1 |
| InChIKey | MFOQKDXSZJHJFU-QSAZIKIQSA-N |
| XLogP | 4.60 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|