C25H33NO5 — CID 10094057
methyl (3S,4S)-3-[(1S)-1-hydroxyethyl]-4-[4-methoxy-3-(3-phenylpropoxy)phenyl]-3-methylpyrrolidine-1-carboxylate (PubChem CID 10094057) has the molecular formula C25H33NO5 and a molecular weight of 427.54 g/mol. Its IUPAC name is methyl (3S,4S)-3-[(1S)-1-hydroxyethyl]-4-[4-methoxy-3-(3-phenylpropoxy)phenyl]-3-methylpyrrolidine-1-carboxylate.
| Compound Name | methyl (3S,4S)-3-[(1S)-1-hydroxyethyl]-4-[4-methoxy-3-(3-phenylpropoxy)phenyl]-3-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10094057 |
| Molecular Formula | C25H33NO5 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | methyl (3S,4S)-3-[(1S)-1-hydroxyethyl]-4-[4-methoxy-3-(3-phenylpropoxy)phenyl]-3-methylpyrrolidine-1-carboxylate |
| SMILES | COC(=O)N1C[C@@H](c2ccc(OC)c(OCCCc3ccccc3)c2)[C@](C)([C@H](C)O)C1 |
| InChI | InChI=1S/C25H33NO5/c1-18(27)25(2)17-26(24(28)30-4)16-21(25)20-12-13-22(29-3)23(15-20)31-14-8-11-19-9-6-5-7-10-19/h5-7,9-10,12-13,15,18,21,27H,8,11,14,16-17H2,1-4H3/t18-,21-,25-/m0/s1 |
| InChIKey | WYUUYHQQSGJFRZ-HMHJJOSWSA-N |
| XLogP | 4.26 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|