C30H38N2O5S — CID 140581570
tert-butyl N-[(2R)-3-hydroxy-2-methyl-1-oxo-1-[4-(5-phenylpentoxy)-3-thiophen-2-ylanilino]propan-2-yl]carbamate (PubChem CID 140581570) has the molecular formula C30H38N2O5S and a molecular weight of 538.71 g/mol. Its IUPAC name is tert-butyl N-[(2R)-3-hydroxy-2-methyl-1-oxo-1-[4-(5-phenylpentoxy)-3-thiophen-2-ylanilino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-3-hydroxy-2-methyl-1-oxo-1-[4-(5-phenylpentoxy)-3-thiophen-2-ylanilino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 140581570 |
| Molecular Formula | C30H38N2O5S |
| Molecular Weight | 538.71 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | tert-butyl N-[(2R)-3-hydroxy-2-methyl-1-oxo-1-[4-(5-phenylpentoxy)-3-thiophen-2-ylanilino]propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@](C)(CO)C(=O)Nc1ccc(OCCCCCc2ccccc2)c(-c2cccs2)c1 |
| InChI | InChI=1S/C30H38N2O5S/c1-29(2,3)37-28(35)32-30(4,21-33)27(34)31-23-16-17-25(24(20-23)26-15-11-19-38-26)36-18-10-6-9-14-22-12-7-5-8-13-22/h5,7-8,11-13,15-17,19-20,33H,6,9-10,14,18,21H2,1-4H3,(H,31,34)(H,32,35)/t30-/m1/s1 |
| InChIKey | HWQDFTXFVLHIKD-SSEXGKCCSA-N |
| XLogP | 6.42 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.71 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|