C12H20NO4P — CID 177244410
4-[2-(2-aminoethyl)phenoxy]butylphosphonic acid (PubChem CID 177244410) has the molecular formula C12H20NO4P and a molecular weight of 273.27 g/mol. Its IUPAC name is 4-[2-(2-aminoethyl)phenoxy]butylphosphonic acid.
| Compound Name | 4-[2-(2-aminoethyl)phenoxy]butylphosphonic acid |
|---|---|
| PubChem CID | 177244410 |
| Molecular Formula | C12H20NO4P |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 4-[2-(2-aminoethyl)phenoxy]butylphosphonic acid |
| SMILES | NCCc1ccccc1OCCCCP(=O)(O)O |
| InChI | InChI=1S/C12H20NO4P/c13-8-7-11-5-1-2-6-12(11)17-9-3-4-10-18(14,15)16/h1-2,5-6H,3-4,7-10,13H2,(H2,14,15,16) |
| InChIKey | GRDTVBZLRBMMGJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|