C32H49O5P — CID 139934497
10-(3-dec-9-enoxy-2-phenylphenoxy)decylphosphonic acid (PubChem CID 139934497) has the molecular formula C32H49O5P and a molecular weight of 544.71 g/mol. Its IUPAC name is 10-(3-dec-9-enoxy-2-phenylphenoxy)decylphosphonic acid.
| Compound Name | 10-(3-dec-9-enoxy-2-phenylphenoxy)decylphosphonic acid |
|---|---|
| PubChem CID | 139934497 |
| Molecular Formula | C32H49O5P |
| Molecular Weight | 544.71 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | 10-(3-dec-9-enoxy-2-phenylphenoxy)decylphosphonic acid |
| SMILES | C=CCCCCCCCCOc1cccc(OCCCCCCCCCCP(=O)(O)O)c1-c1ccccc1 |
| InChI | InChI=1S/C32H49O5P/c1-2-3-4-5-6-9-12-18-26-36-30-24-21-25-31(32(30)29-22-16-15-17-23-29)37-27-19-13-10-7-8-11-14-20-28-38(33,34)35/h2,15-17,21-25H,1,3-14,18-20,26-28H2,(H2,33,34,35) |
| InChIKey | JVGUNWQWVUDKKE-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.71 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|