C18H27BO4 — CID 10860096
[2,6-bis(hex-5-enoxy)phenyl]boronic acid (PubChem CID 10860096) has the molecular formula C18H27BO4 and a molecular weight of 318.22 g/mol. Its IUPAC name is [2,6-bis(hex-5-enoxy)phenyl]boronic acid.
| Compound Name | [2,6-bis(hex-5-enoxy)phenyl]boronic acid |
|---|---|
| PubChem CID | 10860096 |
| Molecular Formula | C18H27BO4 |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | [2,6-bis(hex-5-enoxy)phenyl]boronic acid |
| SMILES | C=CCCCCOc1cccc(OCCCCC=C)c1B(O)O |
| InChI | InChI=1S/C18H27BO4/c1-3-5-7-9-14-22-16-12-11-13-17(18(16)19(20)21)23-15-10-8-6-4-2/h3-4,11-13,20-21H,1-2,5-10,14-15H2 |
| InChIKey | BCTPDYHRNVHTQW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|