C14H17BrO2 — CID 11077332
2-bromo-1,3-bis(but-3-enoxy)benzene (PubChem CID 11077332) has the molecular formula C14H17BrO2 and a molecular weight of 297.19 g/mol. Its IUPAC name is 2-bromo-1,3-bis(but-3-enoxy)benzene.
| Compound Name | 2-bromo-1,3-bis(but-3-enoxy)benzene |
|---|---|
| PubChem CID | 11077332 |
| Molecular Formula | C14H17BrO2 |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 2-bromo-1,3-bis(but-3-enoxy)benzene |
| SMILES | C=CCCOc1cccc(OCCC=C)c1Br |
| InChI | InChI=1S/C14H17BrO2/c1-3-5-10-16-12-8-7-9-13(14(12)15)17-11-6-4-2/h3-4,7-9H,1-2,5-6,10-11H2 |
| InChIKey | KYBVVZPJVXTNON-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|