C18H20OS — CID 132520291
2-(2-but-3-enoxyphenyl)sulfanyl-1,3-dimethylbenzene (PubChem CID 132520291) has the molecular formula C18H20OS and a molecular weight of 284.42 g/mol. Its IUPAC name is 2-(2-but-3-enoxyphenyl)sulfanyl-1,3-dimethylbenzene.
| Compound Name | 2-(2-but-3-enoxyphenyl)sulfanyl-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 132520291 |
| Molecular Formula | C18H20OS |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2-(2-but-3-enoxyphenyl)sulfanyl-1,3-dimethylbenzene |
| SMILES | C=CCCOc1ccccc1Sc1c(C)cccc1C |
| InChI | InChI=1S/C18H20OS/c1-4-5-13-19-16-11-6-7-12-17(16)20-18-14(2)9-8-10-15(18)3/h4,6-12H,1,5,13H2,2-3H3 |
| InChIKey | DHVSTOZKHJEFQM-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|