C27H39O5P — CID 139934501
6-(3-non-8-enoxy-2-phenylphenoxy)hexylphosphonic acid (PubChem CID 139934501) has the molecular formula C27H39O5P and a molecular weight of 474.58 g/mol. Its IUPAC name is 6-(3-non-8-enoxy-2-phenylphenoxy)hexylphosphonic acid.
| Compound Name | 6-(3-non-8-enoxy-2-phenylphenoxy)hexylphosphonic acid |
|---|---|
| PubChem CID | 139934501 |
| Molecular Formula | C27H39O5P |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 6-(3-non-8-enoxy-2-phenylphenoxy)hexylphosphonic acid |
| SMILES | C=CCCCCCCCOc1cccc(OCCCCCCP(=O)(O)O)c1-c1ccccc1 |
| InChI | InChI=1S/C27H39O5P/c1-2-3-4-5-6-7-13-21-31-25-19-16-20-26(27(25)24-17-11-10-12-18-24)32-22-14-8-9-15-23-33(28,29)30/h2,10-12,16-20H,1,3-9,13-15,21-23H2,(H2,28,29,30) |
| InChIKey | USTAEHRWIKDRQG-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|