C30H44O5S — CID 139944186
5-(2-phenyl-3-undec-10-enoxyphenoxy)heptane-1-sulfonic acid (PubChem CID 139944186) has the molecular formula C30H44O5S and a molecular weight of 516.74 g/mol. Its IUPAC name is 5-(2-phenyl-3-undec-10-enoxyphenoxy)heptane-1-sulfonic acid.
| Compound Name | 5-(2-phenyl-3-undec-10-enoxyphenoxy)heptane-1-sulfonic acid |
|---|---|
| PubChem CID | 139944186 |
| Molecular Formula | C30H44O5S |
| Molecular Weight | 516.74 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | 5-(2-phenyl-3-undec-10-enoxyphenoxy)heptane-1-sulfonic acid |
| SMILES | C=CCCCCCCCCCOc1cccc(OC(CC)CCCCS(=O)(=O)O)c1-c1ccccc1 |
| InChI | InChI=1S/C30H44O5S/c1-3-5-6-7-8-9-10-11-16-24-34-28-22-18-23-29(30(28)26-19-13-12-14-20-26)35-27(4-2)21-15-17-25-36(31,32)33/h3,12-14,18-20,22-23,27H,1,4-11,15-17,21,24-25H2,2H3,(H,31,32,33) |
| InChIKey | MZODMWIOAZBGAV-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.74 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|