C29H44O5S — CID 139975263
10-(3-heptoxy-2-phenylphenoxy)decane-1-sulfonic acid (PubChem CID 139975263) has the molecular formula C29H44O5S and a molecular weight of 504.73 g/mol. Its IUPAC name is 10-(3-heptoxy-2-phenylphenoxy)decane-1-sulfonic acid.
| Compound Name | 10-(3-heptoxy-2-phenylphenoxy)decane-1-sulfonic acid |
|---|---|
| PubChem CID | 139975263 |
| Molecular Formula | C29H44O5S |
| Molecular Weight | 504.73 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | 10-(3-heptoxy-2-phenylphenoxy)decane-1-sulfonic acid |
| SMILES | CCCCCCCOc1cccc(OCCCCCCCCCCS(=O)(=O)O)c1-c1ccccc1 |
| InChI | InChI=1S/C29H44O5S/c1-2-3-4-9-15-23-33-27-21-18-22-28(29(27)26-19-13-12-14-20-26)34-24-16-10-7-5-6-8-11-17-25-35(30,31)32/h12-14,18-22H,2-11,15-17,23-25H2,1H3,(H,30,31,32) |
| InChIKey | SKCBGSCKMTYQSR-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.73 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|