C26H24N2O2 — CID 156809342
2-[[6-(4-ethylphenyl)-4-phenylquinolin-2-yl]-methylamino]acetic acid (PubChem CID 156809342) has the molecular formula C26H24N2O2 and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-[[6-(4-ethylphenyl)-4-phenylquinolin-2-yl]-methylamino]acetic acid.
| Compound Name | 2-[[6-(4-ethylphenyl)-4-phenylquinolin-2-yl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 156809342 |
| Molecular Formula | C26H24N2O2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 2-[[6-(4-ethylphenyl)-4-phenylquinolin-2-yl]-methylamino]acetic acid |
| SMILES | CCc1ccc(-c2ccc3nc(N(C)CC(=O)O)cc(-c4ccccc4)c3c2)cc1 |
| InChI | InChI=1S/C26H24N2O2/c1-3-18-9-11-19(12-10-18)21-13-14-24-23(15-21)22(20-7-5-4-6-8-20)16-25(27-24)28(2)17-26(29)30/h4-16H,3,17H2,1-2H3,(H,29,30) |
| InChIKey | CRVRUBHSNKCVGB-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |